C11H19NO4S — CID 97380481
(4aS,7R,7aR)-4-cyclopropylsulfonyl-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97380481) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97380481 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CO[C@@H]1CC[C@H]2[C@H]1OCCN2S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C11H19NO4S/c1-15-10-5-4-9-11(10)16-7-6-12(9)17(13,14)8-2-3-8/h8-11H,2-7H2,1H3/t9-,10+,11+/m0/s1 |
| InChIKey | HZCGQFVXCXACCR-HBNTYKKESA-N |
| XLogP | 0.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |