C15H21N3O3 — CID 97380858
(3S,3aS,7aR)-N,N-dimethyl-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide (PubChem CID 97380858) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3S,3aS,7aR)-N,N-dimethyl-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,7aR)-N,N-dimethyl-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 97380858 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3S,3aS,7aR)-N,N-dimethyl-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@H](Oc2ccccn2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C15H21N3O3/c1-17(2)15(19)18-10-12(14-11(18)6-5-9-20-14)21-13-7-3-4-8-16-13/h3-4,7-8,11-12,14H,5-6,9-10H2,1-2H3/t11-,12+,14+/m1/s1 |
| InChIKey | PJWCQSQPQBLCQW-DYEKYZERSA-N |
| XLogP | 1.37 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |