C16H20N4O3 — CID 97380889
[(2R,3aS,7aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 97380889) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(2R,3aS,7aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1-methylpyrrol-2-yl)methanone.
| Compound Name | [(2R,3aS,7aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1-methylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 97380889 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(2R,3aS,7aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | Cc1noc([C@H]2C[C@@H]3CCN(C(=O)c4cccn4C)C[C@H]3O2)n1 |
| InChI | InChI=1S/C16H20N4O3/c1-10-17-15(23-18-10)13-8-11-5-7-20(9-14(11)22-13)16(21)12-4-3-6-19(12)2/h3-4,6,11,13-14H,5,7-9H2,1-2H3/t11-,13+,14+/m0/s1 |
| InChIKey | DJRMEQSURKOZHZ-IACUBPJLSA-N |
| XLogP | 1.71 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |