C18H26FN5O — CID 97381525
2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 97381525) has the molecular formula C18H26FN5O and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 97381525 |
| Molecular Formula | C18H26FN5O |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCc1nnc2n1CCN(Cc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C18H26FN5O/c1-22(2)11-12-25-14-18-21-20-17-7-8-23(9-10-24(17)18)13-15-3-5-16(19)6-4-15/h3-6H,7-14H2,1-2H3 |
| InChIKey | ZOENBFHCWRPTLV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|