C19H24N8O2 — CID 97382308
1-methyl-N-[[9-[(1-methylpyrazol-4-yl)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]pyrazole-4-carboxamide (PubChem CID 97382308) has the molecular formula C19H24N8O2 and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-methyl-N-[[9-[(1-methylpyrazol-4-yl)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[[9-[(1-methylpyrazol-4-yl)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97382308 |
| Molecular Formula | C19H24N8O2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-methyl-N-[[9-[(1-methylpyrazol-4-yl)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(CN2CCCn3c(nc(CNC(=O)c4cnn(C)c4)cc3=O)C2)cn1 |
| InChI | InChI=1S/C19H24N8O2/c1-24-10-14(7-21-24)11-26-4-3-5-27-17(13-26)23-16(6-18(27)28)9-20-19(29)15-8-22-25(2)12-15/h6-8,10,12H,3-5,9,11,13H2,1-2H3,(H,20,29) |
| InChIKey | CHLPSVVQQHCQND-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |