About (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide
(2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide (PubChem CID 97383758) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
| PubChem CID | 97383758 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCC2(CCN(Cc3cnn(C)c3)CC2)O1 |
| InChI | InChI=1S/C16H26N4O2/c1-18(2)15(21)14-4-5-16(22-14)6-8-20(9-7-16)12-13-10-17-19(3)11-13/h10-11,14H,4-9,12H2,1-3H3/t14-/m1/s1 |
| InChIKey | KMOIFIGUUNAPEC-CQSZACIVSA-N |
| XLogP | 1.02 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide?
The IUPAC name of (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide (CID 97383758) is (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide.
What is the SMILES notation for (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide?
The canonical SMILES for (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide is CN(C)C(=O)[C@H]1CCC2(CCN(Cc3cnn(C)c3)CC2)O1.
What is the InChIKey of (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide?
The InChIKey is KMOIFIGUUNAPEC-CQSZACIVSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-18(2)15(21)14-4-5-16(22-14)6-8-20(9-7-16)12-13-10-17-19(3)11-13/h10-11,14H,4-9,12H2,1-3H3/t14-/m1/s1.
What are the key properties of (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide?
(2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide has a molecular weight of 306.41 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,N-dimethyl-8-[(1-methylpyrazol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decane-2-carboxamide is sourced from PubChem (CID 97383758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).