About (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide
(2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 97384189) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide |
| PubChem CID | 97384189 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC[C@@H](O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2O2/c1-15(2)14(18)16-9-8-13(17)12(16)10-11-6-4-3-5-7-11/h3-7,12-13,17H,8-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OPZMQWZIPFCSFA-QWHCGFSZSA-N |
| XLogP | 1.35 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide?
The IUPAC name of (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide (CID 97384189) is (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide.
What is the SMILES notation for (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide?
The canonical SMILES for (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide is CN(C)C(=O)N1CC[C@@H](O)[C@@H]1Cc1ccccc1.
What is the InChIKey of (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide?
The InChIKey is OPZMQWZIPFCSFA-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-15(2)14(18)16-9-8-13(17)12(16)10-11-6-4-3-5-7-11/h3-7,12-13,17H,8-10H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide?
(2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide has a molecular weight of 248.33 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-benzyl-3-hydroxy-N,N-dimethylpyrrolidine-1-carboxamide is sourced from PubChem (CID 97384189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).