About [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone
[(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 97384315) has the molecular formula C20H24N2O2S
and a molecular weight of 356.49 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 97384315 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CC[C@@H](N2CCOCC2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O2S/c23-20(17-7-13-25-15-17)22-8-6-18(21-9-11-24-12-10-21)19(22)14-16-4-2-1-3-5-16/h1-5,7,13,15,18-19H,6,8-12,14H2/t18-,19+/m1/s1 |
| InChIKey | LGGJVVJXWOAWPV-MOPGFXCFSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone (CID 97384315) is [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone is O=C(c1ccsc1)N1CC[C@@H](N2CCOCC2)[C@@H]1Cc1ccccc1.
What is the InChIKey of [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone?
The InChIKey is LGGJVVJXWOAWPV-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H24N2O2S/c23-20(17-7-13-25-15-17)22-8-6-18(21-9-11-24-12-10-21)19(22)14-16-4-2-1-3-5-16/h1-5,7,13,15,18-19H,6,8-12,14H2/t18-,19+/m1/s1.
What are the key properties of [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone?
[(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone has a molecular weight of 356.49 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 97384315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).