C19H23N3O — CID 97384384
(3aR,4R,6aS)-2-(cyclopropylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 97384384) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-(cyclopropylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aR,4R,6aS)-2-(cyclopropylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 97384384 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (3aR,4R,6aS)-2-(cyclopropylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | O=C1NC(c2ccccc2)=N[C@@]12CC[C@@H]1CN(CC3CC3)C[C@@H]12 |
| InChI | InChI=1S/C19H23N3O/c23-18-19(21-17(20-18)14-4-2-1-3-5-14)9-8-15-11-22(12-16(15)19)10-13-6-7-13/h1-5,13,15-16H,6-12H2,(H,20,21,23)/t15-,16+,19-/m1/s1 |
| InChIKey | FEDNFBHTBICJOQ-JTDSTZFVSA-N |
| XLogP | 2.05 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |