C21H27N3O2 — CID 97384385
(3aR,4R,6aS)-2-(oxan-4-ylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 97384385) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-(oxan-4-ylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aR,4R,6aS)-2-(oxan-4-ylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 97384385 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (3aR,4R,6aS)-2-(oxan-4-ylmethyl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | O=C1NC(c2ccccc2)=N[C@@]12CC[C@@H]1CN(CC3CCOCC3)C[C@@H]12 |
| InChI | InChI=1S/C21H27N3O2/c25-20-21(23-19(22-20)16-4-2-1-3-5-16)9-6-17-13-24(14-18(17)21)12-15-7-10-26-11-8-15/h1-5,15,17-18H,6-14H2,(H,22,23,25)/t17-,18+,21-/m1/s1 |
| InChIKey | VCMHIAICTRNURA-LVCYWYKZSA-N |
| XLogP | 2.07 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |