C16H24N4O3 — CID 97386187
(2R,3aR,6aR)-1-acetyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97386187) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-acetyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-1-acetyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97386187 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R,3aR,6aR)-1-acetyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(Cc3c(C)noc3C)C[C@@H]2N1C(C)=O |
| InChI | InChI=1S/C16H24N4O3/c1-9-13(10(2)23-18-9)7-19-6-12-5-14(16(22)17-4)20(11(3)21)15(12)8-19/h12,14-15H,5-8H2,1-4H3,(H,17,22)/t12-,14-,15+/m1/s1 |
| InChIKey | MDDYJJCGIVWENE-YUELXQCFSA-N |
| XLogP | 0.46 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |