C17H25N3O — CID 97386240
(7R,8aS)-7-(cyclopropylmethoxy)-2-(6-methyl-2-pyridinyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97386240) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (7R,8aS)-7-(cyclopropylmethoxy)-2-(6-methyl-2-pyridinyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-(6-methyl-2-pyridinyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97386240 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-(6-methyl-2-pyridinyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cccc(N2CCN3C[C@H](OCC4CC4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C17H25N3O/c1-13-3-2-4-17(18-13)20-8-7-19-11-16(9-15(19)10-20)21-12-14-5-6-14/h2-4,14-16H,5-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | NTSXZNSYZYPNBS-JKSUJKDBSA-N |
| XLogP | 2.08 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |