C16H22N4O4 — CID 97386289
[(2R,3aS,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone (PubChem CID 97386289) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(2R,3aS,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2R,3aS,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97386289 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(2R,3aS,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(N2CC[C@@H]3O[C@@H](C(=O)N4CCOCC4)C[C@@H]32)ncn1 |
| InChI | InChI=1S/C16H22N4O4/c1-22-15-9-14(17-10-18-15)20-3-2-12-11(20)8-13(24-12)16(21)19-4-6-23-7-5-19/h9-13H,2-8H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | FWAHSSNWENGROW-RWMBFGLXSA-N |
| XLogP | 0.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |