C14H13N3O2S2 — CID 97386389
(3aR,6aS)-1-(1,3-thiazole-4-carbonyl)-4-thiophen-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 97386389) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is (3aR,6aS)-1-(1,3-thiazole-4-carbonyl)-4-thiophen-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aR,6aS)-1-(1,3-thiazole-4-carbonyl)-4-thiophen-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 97386389 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (3aR,6aS)-1-(1,3-thiazole-4-carbonyl)-4-thiophen-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C(c1cscn1)N1CC[C@@H]2[C@@H]1CC(=O)N2c1ccsc1 |
| InChI | InChI=1S/C14H13N3O2S2/c18-13-5-12-11(17(13)9-2-4-20-6-9)1-3-16(12)14(19)10-7-21-8-15-10/h2,4,6-8,11-12H,1,3,5H2/t11-,12+/m1/s1 |
| InChIKey | PRHFAJFZESUFKH-NEPJUHHUSA-N |
| XLogP | 2.22 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |