C12H13FN6S — CID 97386551
2-[(3aR,6aS)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole (PubChem CID 97386551) has the molecular formula C12H13FN6S and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[(3aR,6aS)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole.
| Compound Name | 2-[(3aR,6aS)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 97386551 |
| Molecular Formula | C12H13FN6S |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(3aR,6aS)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole |
| SMILES | Fc1cnc(N2CC[C@@H]3[C@@H]2CCN3c2nncs2)nc1 |
| InChI | InChI=1S/C12H13FN6S/c13-8-5-14-11(15-6-8)18-3-1-10-9(18)2-4-19(10)12-17-16-7-20-12/h5-7,9-10H,1-4H2/t9-,10+/m0/s1 |
| InChIKey | CIKBVCJPJKVFTA-VHSXEESVSA-N |
| XLogP | 1.32 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |