C17H21N3O2 — CID 97386636
[(3S,3aR,6aS)-3-(dimethylamino)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone (PubChem CID 97386636) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(3S,3aR,6aS)-3-(dimethylamino)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(3S,3aR,6aS)-3-(dimethylamino)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 97386636 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | [(3S,3aR,6aS)-3-(dimethylamino)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone |
| SMILES | CN(C)[C@@H]1CN(C(=O)c2ccc3[nH]ccc3c2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C17H21N3O2/c1-19(2)15-8-20(16-10-22-9-13(15)16)17(21)12-3-4-14-11(7-12)5-6-18-14/h3-7,13,15-16,18H,8-10H2,1-2H3/t13-,15-,16-/m1/s1 |
| InChIKey | FYRHEJFHZANEGN-FVQBIDKESA-N |
| XLogP | 1.57 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |