C18H31N5O — CID 97386837
(2S,3aR,7aS)-5-(oxan-4-yl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 97386837) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is (2S,3aR,7aS)-5-(oxan-4-yl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2S,3aR,7aS)-5-(oxan-4-yl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 97386837 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (2S,3aR,7aS)-5-(oxan-4-yl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CC(C)N1[C@H](Cn2cncn2)C[C@@H]2CN(C3CCOCC3)CC[C@@H]21 |
| InChI | InChI=1S/C18H31N5O/c1-14(2)23-17(11-22-13-19-12-20-22)9-15-10-21(6-3-18(15)23)16-4-7-24-8-5-16/h12-18H,3-11H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | KOBCCXALDMBRFY-NJAFHUGGSA-N |
| XLogP | 1.63 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |