C16H22N6OS — CID 97386842
1-[(2S,3aR,7aS)-5-(1,3-thiazol-2-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 97386842) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-5-(1,3-thiazol-2-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2S,3aR,7aS)-5-(1,3-thiazol-2-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 97386842 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[(2S,3aR,7aS)-5-(1,3-thiazol-2-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](Cn2cncn2)C[C@@H]2CN(Cc3nccs3)CC[C@@H]21 |
| InChI | InChI=1S/C16H22N6OS/c1-12(23)22-14(8-21-11-17-10-19-21)6-13-7-20(4-2-15(13)22)9-16-18-3-5-24-16/h3,5,10-11,13-15H,2,4,6-9H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | KWUYXXMTLHCLIL-ILXRZTDVSA-N |
| XLogP | 1.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |