C16H26N6O — CID 97386948
(2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97386948) has the molecular formula C16H26N6O and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97386948 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3aS,6aS)-N-[2-(dimethylamino)ethyl]-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CN(C)CCNC(=O)[C@H]1C[C@H]2CN(c3ncccn3)C[C@H]2N1C |
| InChI | InChI=1S/C16H26N6O/c1-20(2)8-7-17-15(23)13-9-12-10-22(11-14(12)21(13)3)16-18-5-4-6-19-16/h4-6,12-14H,7-11H2,1-3H3,(H,17,23)/t12-,13+,14+/m0/s1 |
| InChIKey | DJBVTUPPVUGRJJ-BFHYXJOUSA-N |
| XLogP | -0.34 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |