C15H12N2O3 — CID 973870
N-(furan-2-ylmethyl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 973870) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 973870 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H12N2O3/c18-15(16-10-12-7-4-8-19-12)13-9-14(20-17-13)11-5-2-1-3-6-11/h1-9H,10H2,(H,16,18) |
| InChIKey | RXZVXOLXBOIXNY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |