C18H26N6O — CID 97387016
(3R,3aS,7aR)-N-methyl-1-[(1-methylimidazol-2-yl)methyl]-N-(pyrimidin-5-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine (PubChem CID 97387016) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is (3R,3aS,7aR)-N-methyl-1-[(1-methylimidazol-2-yl)methyl]-N-(pyrimidin-5-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine.
| Compound Name | (3R,3aS,7aR)-N-methyl-1-[(1-methylimidazol-2-yl)methyl]-N-(pyrimidin-5-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97387016 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (3R,3aS,7aR)-N-methyl-1-[(1-methylimidazol-2-yl)methyl]-N-(pyrimidin-5-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
| SMILES | CN(Cc1cncnc1)[C@@H]1CN(Cc2nccn2C)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C18H26N6O/c1-22-6-5-21-17(22)12-24-11-16(18-15(24)4-3-7-25-18)23(2)10-14-8-19-13-20-9-14/h5-6,8-9,13,15-16,18H,3-4,7,10-12H2,1-2H3/t15-,16-,18+/m1/s1 |
| InChIKey | SDIWQSDLPIJTBQ-NUJGCVRESA-N |
| XLogP | 1.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |