C16H22N4O3 — CID 97387165
(2S,3aS,6aS)-N-(cyclopropylmethyl)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide (PubChem CID 97387165) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S,3aS,6aS)-N-(cyclopropylmethyl)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide.
| Compound Name | (2S,3aS,6aS)-N-(cyclopropylmethyl)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97387165 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2S,3aS,6aS)-N-(cyclopropylmethyl)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
| SMILES | COc1cc(N2CC[C@@H]3O[C@H](C(=O)NCC4CC4)C[C@@H]32)ncn1 |
| InChI | InChI=1S/C16H22N4O3/c1-22-15-7-14(18-9-19-15)20-5-4-12-11(20)6-13(23-12)16(21)17-8-10-2-3-10/h7,9-13H,2-6,8H2,1H3,(H,17,21)/t11-,12-,13-/m0/s1 |
| InChIKey | ZEZFUGWYDYCREM-AVGNSLFASA-N |
| XLogP | 0.75 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |