C16H23N3O3S — CID 97387170
[(2S,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone (PubChem CID 97387170) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is [(2S,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97387170 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(2S,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nc(CN2CC[C@@H]3O[C@H](C(=O)N4CCOCC4)C[C@@H]32)cs1 |
| InChI | InChI=1S/C16H23N3O3S/c1-11-17-12(10-23-11)9-19-3-2-14-13(19)8-15(22-14)16(20)18-4-6-21-7-5-18/h10,13-15H,2-9H2,1H3/t13-,14-,15-/m0/s1 |
| InChIKey | SGQBQMWZHROLSE-KKUMJFAQSA-N |
| XLogP | 1.04 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |