C17H25N3O4 — CID 97387263
[(3aR,7aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone (PubChem CID 97387263) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3aR,7aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,7aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97387263 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(3aR,7aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(CN2CC[C@H]3OCC[C@@]3(C(=O)N3CCOCC3)C2)no1 |
| InChI | InChI=1S/C17H25N3O4/c1-13-10-14(18-24-13)11-19-4-2-15-17(12-19,3-7-23-15)16(21)20-5-8-22-9-6-20/h10,15H,2-9,11-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | WUKFVVWSNDPESO-NVXWUHKLSA-N |
| XLogP | 0.82 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |