C19H29N3O3 — CID 97387570
[(4aS,8R,8aS)-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone (PubChem CID 97387570) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(4aS,8R,8aS)-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone.
| Compound Name | [(4aS,8R,8aS)-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 97387570 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(4aS,8R,8aS)-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2,5-dimethyl-1H-pyrrol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@@H]3CCCO[C@@H]3[C@H](N3CCOCC3)C2)c(C)[nH]1 |
| InChI | InChI=1S/C19H29N3O3/c1-13-10-16(14(2)20-13)19(23)22-11-15-4-3-7-25-18(15)17(12-22)21-5-8-24-9-6-21/h10,15,17-18,20H,3-9,11-12H2,1-2H3/t15-,17+,18-/m0/s1 |
| InChIKey | GBFPUXOBYNNRIX-JQHSSLGASA-N |
| XLogP | 1.58 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |