C18H22N6O2 — CID 97387744
(3aR,5S,7aR)-N-[(5-methylpyrazin-2-yl)methyl]-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97387744) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-[(5-methylpyrazin-2-yl)methyl]-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5S,7aR)-N-[(5-methylpyrazin-2-yl)methyl]-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97387744 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (3aR,5S,7aR)-N-[(5-methylpyrazin-2-yl)methyl]-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1cnc(CNC(=O)[C@@H]2CC[C@@H]3[C@@H](CCN3c3ccncn3)O2)cn1 |
| InChI | InChI=1S/C18H22N6O2/c1-12-8-21-13(9-20-12)10-22-18(25)16-3-2-14-15(26-16)5-7-24(14)17-4-6-19-11-23-17/h4,6,8-9,11,14-16H,2-3,5,7,10H2,1H3,(H,22,25)/t14-,15-,16+/m1/s1 |
| InChIKey | KZRNYJJFKOTWTL-OAGGEKHMSA-N |
| XLogP | 1.02 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |