C17H27N3O2 — CID 97387842
(3S,3aS,7aR)-1-cyclobutyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97387842) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3S,3aS,7aR)-1-cyclobutyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aS,7aR)-1-cyclobutyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97387842 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (3S,3aS,7aR)-1-cyclobutyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1cnn(CCCO[C@H]2CN(C3CCC3)[C@@H]3CCCO[C@H]23)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-5-14(6-1)20-13-16(17-15(20)7-2-11-22-17)21-12-4-10-19-9-3-8-18-19/h3,8-9,14-17H,1-2,4-7,10-13H2/t15-,16+,17+/m1/s1 |
| InChIKey | UFIWLFKFPFLLFN-IKGGRYGDSA-N |
| XLogP | 2.07 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|