C16H18N6O2 — CID 97387919
(3aR,5R,7aR)-N-pyrazin-2-yl-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97387919) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-pyrazin-2-yl-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5R,7aR)-N-pyrazin-2-yl-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97387919 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3aR,5R,7aR)-N-pyrazin-2-yl-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@H]1CC[C@@H]2[C@@H](CCN2c2ccncn2)O1 |
| InChI | InChI=1S/C16H18N6O2/c23-16(21-14-9-17-6-7-19-14)13-2-1-11-12(24-13)4-8-22(11)15-3-5-18-10-20-15/h3,5-7,9-13H,1-2,4,8H2,(H,19,21,23)/t11-,12-,13-/m1/s1 |
| InChIKey | MZPRMDMIGBUIJJ-JHJVBQTASA-N |
| XLogP | 1.03 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |