C17H25N5O3 — CID 97388012
[(1S,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-morpholin-4-ylmethanone (PubChem CID 97388012) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(1S,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(1S,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97388012 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | [(1S,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CC[C@@H]2[C@@H](CO[C@@H]2CNc2ncccn2)C1 |
| InChI | InChI=1S/C17H25N5O3/c23-17(21-6-8-24-9-7-21)22-5-2-14-13(11-22)12-25-15(14)10-20-16-18-3-1-4-19-16/h1,3-4,13-15H,2,5-12H2,(H,18,19,20)/t13-,14-,15-/m1/s1 |
| InChIKey | NRNRUSMWASQASO-RBSFLKMASA-N |
| XLogP | 0.68 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |