C17H23NO3S — CID 97388163
[(4aS,7R,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 97388163) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(4aS,7R,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 97388163 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(4aS,7R,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCO[C@H]3[C@H](OCC4CC4)CC[C@@H]32)s1 |
| InChI | InChI=1S/C17H23NO3S/c1-11-2-7-15(22-11)17(19)18-8-9-20-16-13(18)5-6-14(16)21-10-12-3-4-12/h2,7,12-14,16H,3-6,8-10H2,1H3/t13-,14+,16+/m0/s1 |
| InChIKey | JCDPDZYNZRPRBI-SQWLQELKSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |