C17H23N5O2 — CID 97388219
(4aS,7R,7aR)-7-(3-pyrazol-1-ylpropoxy)-4-pyrimidin-4-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97388219) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-(3-pyrazol-1-ylpropoxy)-4-pyrimidin-4-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7R,7aR)-7-(3-pyrazol-1-ylpropoxy)-4-pyrimidin-4-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97388219 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (4aS,7R,7aR)-7-(3-pyrazol-1-ylpropoxy)-4-pyrimidin-4-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1cnn(CCCO[C@@H]2CC[C@H]3[C@H]2OCCN3c2ccncn2)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-6-20-21(8-1)9-2-11-23-15-4-3-14-17(15)24-12-10-22(14)16-5-7-18-13-19-16/h1,5-8,13-15,17H,2-4,9-12H2/t14-,15+,17+/m0/s1 |
| InChIKey | VUCPHGFCHJQFJR-ZMSDIMECSA-N |
| XLogP | 1.52 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|