C13H16N4O2 — CID 97388943
1-[3-(2,5-dihydropyrrole-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 97388943) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[3-(2,5-dihydropyrrole-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[3-(2,5-dihydropyrrole-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 97388943 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[3-(2,5-dihydropyrrole-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CCc2[nH]nc(C(=O)N3CC=CC3)c2C1 |
| InChI | InChI=1S/C13H16N4O2/c1-9(18)17-7-4-11-10(8-17)12(15-14-11)13(19)16-5-2-3-6-16/h2-3H,4-8H2,1H3,(H,14,15) |
| InChIKey | JRPATCHLHRTVGM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|