C16H21N5O2S — CID 97390209
[3-(morpholin-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97390209) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is [3-(morpholin-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [3-(morpholin-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97390209 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [3-(morpholin-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCc2ncc(CN3CCOCC3)n2CC1 |
| InChI | InChI=1S/C16H21N5O2S/c22-16(14-11-24-12-18-14)20-2-1-15-17-9-13(21(15)4-3-20)10-19-5-7-23-8-6-19/h9,11-12H,1-8,10H2 |
| InChIKey | PVPKWBLUPQADGT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |