C18H29N5O — CID 97390239
2-[3-[[furan-2-ylmethyl(methyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-N,N-dimethylethanamine (PubChem CID 97390239) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[3-[[furan-2-ylmethyl(methyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[3-[[furan-2-ylmethyl(methyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 97390239 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 2-[3-[[furan-2-ylmethyl(methyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCc2ncc(CN(C)Cc3ccco3)n2CC1 |
| InChI | InChI=1S/C18H29N5O/c1-20(2)8-9-22-7-6-18-19-13-16(23(18)11-10-22)14-21(3)15-17-5-4-12-24-17/h4-5,12-13H,6-11,14-15H2,1-3H3 |
| InChIKey | QHWITVYIOMWZHY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |