C16H18N4O3 — CID 973904
8-(3,4-dimethylphenoxy)-1,3,7-trimethylpurine-2,6-dione (PubChem CID 973904) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 8-(3,4-dimethylphenoxy)-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-(3,4-dimethylphenoxy)-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 973904 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 8-(3,4-dimethylphenoxy)-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cc1ccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc1C |
| InChI | InChI=1S/C16H18N4O3/c1-9-6-7-11(8-10(9)2)23-15-17-13-12(18(15)3)14(21)20(5)16(22)19(13)4/h6-8H,1-5H3 |
| InChIKey | KQAWICQCCNBHBU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |