About [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone
[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 97391868) has the molecular formula C18H22N2O4
and a molecular weight of 330.38 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone |
| PubChem CID | 97391868 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | COCCO[C@@H]1CCN(C(=O)c2ccno2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-22-11-12-23-16-8-10-20(18(21)17-7-9-19-24-17)15(16)13-14-5-3-2-4-6-14/h2-7,9,15-16H,8,10-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | KXWBUQNCIITZRW-JKSUJKDBSA-N |
| XLogP | 2.16 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone?
The IUPAC name of [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone (CID 97391868) is [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone.
What is the SMILES notation for [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone?
The canonical SMILES for [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone is COCCO[C@@H]1CCN(C(=O)c2ccno2)[C@H]1Cc1ccccc1.
What is the InChIKey of [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone?
The InChIKey is KXWBUQNCIITZRW-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H22N2O4/c1-22-11-12-23-16-8-10-20(18(21)17-7-9-19-24-17)15(16)13-14-5-3-2-4-6-14/h2-7,9,15-16H,8,10-13H2,1H3/t15-,16+/m0/s1.
What are the key properties of [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone?
[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone has a molecular weight of 330.38 g/mol, XLogP of 2.16, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(1,2-oxazol-5-yl)methanone is sourced from PubChem (CID 97391868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).