C17H25N5O — CID 97391917
1-methyl-2-[[(2S,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]methyl]imidazole (PubChem CID 97391917) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-methyl-2-[[(2S,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]methyl]imidazole.
| Compound Name | 1-methyl-2-[[(2S,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]methyl]imidazole |
|---|---|
| PubChem CID | 97391917 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-methyl-2-[[(2S,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]methyl]imidazole |
| SMILES | C=CCO[C@@H]1CCN(Cc2nccn2C)[C@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C17H25N5O/c1-4-9-23-16-5-7-22(13-17-18-6-8-20(17)2)15(16)10-14-11-19-21(3)12-14/h4,6,8,11-12,15-16H,1,5,7,9-10,13H2,2-3H3/t15-,16+/m0/s1 |
| InChIKey | OKYOSSOQRJWTSI-JKSUJKDBSA-N |
| XLogP | 1.54 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|