C16H21N7O — CID 97392197
3,5-dimethyl-4-[[(8R)-8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,2-oxazole (PubChem CID 97392197) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[(8R)-8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[[(8R)-8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 97392197 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3,5-dimethyl-4-[[(8R)-8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1CN1CCn2c(Cn3cncn3)cnc2[C@H]1C |
| InChI | InChI=1S/C16H21N7O/c1-11-15(13(3)24-20-11)8-21-4-5-23-14(6-18-16(23)12(21)2)7-22-10-17-9-19-22/h6,9-10,12H,4-5,7-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | FGHUQKVZYJRHAL-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 77.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |