C17H19N3O3S — CID 97392488
[(2S,3aS,6aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 97392488) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(2S,3aS,6aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 97392488 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [(2S,3aS,6aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@@H]3C[C@@H](c4nnc(C5CC5)o4)O[C@@H]3C2)s1 |
| InChI | InChI=1S/C17H19N3O3S/c1-9-2-5-14(24-9)17(21)20-7-11-6-12(22-13(11)8-20)16-19-18-15(23-16)10-3-4-10/h2,5,10-13H,3-4,6-8H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | BSOBZTYIHHUHSR-RWMBFGLXSA-N |
| XLogP | 2.92 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |