C16H19N5O2 — CID 97392581
(2R,3aS,7aS)-5-(6-methoxypyrimidin-4-yl)-2-pyrimidin-4-yl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 97392581) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2R,3aS,7aS)-5-(6-methoxypyrimidin-4-yl)-2-pyrimidin-4-yl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (2R,3aS,7aS)-5-(6-methoxypyrimidin-4-yl)-2-pyrimidin-4-yl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 97392581 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2R,3aS,7aS)-5-(6-methoxypyrimidin-4-yl)-2-pyrimidin-4-yl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | COc1cc(N2CC[C@@H]3O[C@@H](c4ccncn4)C[C@H]3C2)ncn1 |
| InChI | InChI=1S/C16H19N5O2/c1-22-16-7-15(19-10-20-16)21-5-3-13-11(8-21)6-14(23-13)12-2-4-17-9-18-12/h2,4,7,9-11,13-14H,3,5-6,8H2,1H3/t11-,13-,14+/m0/s1 |
| InChIKey | WDZJGQFECNRUME-FPMFFAJLSA-N |
| XLogP | 1.63 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |