About (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone
(7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone (PubChem CID 97392729) has the molecular formula C12H17N3O3S2
and a molecular weight of 315.42 g/mol. Its IUPAC name is (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone |
| PubChem CID | 97392729 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone |
| SMILES | CCS(=O)(=O)N1CCC2(CN(C(=O)c3cscn3)C2)C1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-2-20(17,18)15-4-3-12(8-15)6-14(7-12)11(16)10-5-19-9-13-10/h5,9H,2-4,6-8H2,1H3 |
| InChIKey | XANKBOQBMWTGIH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone?
The IUPAC name of (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone (CID 97392729) is (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone is CCS(=O)(=O)N1CCC2(CN(C(=O)c3cscn3)C2)C1.
What is the InChIKey of (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone?
The InChIKey is XANKBOQBMWTGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S2/c1-2-20(17,18)15-4-3-12(8-15)6-14(7-12)11(16)10-5-19-9-13-10/h5,9H,2-4,6-8H2,1H3.
What are the key properties of (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone?
(7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone has a molecular weight of 315.42 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethylsulfonyl-2,7-diazaspiro[3.4]octan-2-yl)-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 97392729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).