About 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone
1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone (PubChem CID 97394314) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone.
Molecular Properties
| Compound Name | 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
| PubChem CID | 97394314 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
| SMILES | O=C(c1ccno1)N1CC[C@]2(C[C@H](OCc3ccccc3)CO2)C1 |
| InChI | InChI=1S/C18H20N2O4/c21-17(16-6-8-19-24-16)20-9-7-18(13-20)10-15(12-23-18)22-11-14-4-2-1-3-5-14/h1-6,8,15H,7,9-13H2/t15-,18-/m0/s1 |
| InChIKey | IJCLFKZROBZPJS-YJBOKZPZSA-N |
| XLogP | 2.27 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone?
The IUPAC name of 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone (CID 97394314) is 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone.
What is the SMILES notation for 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone?
The canonical SMILES for 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone is O=C(c1ccno1)N1CC[C@]2(C[C@H](OCc3ccccc3)CO2)C1.
What is the InChIKey of 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone?
The InChIKey is IJCLFKZROBZPJS-YJBOKZPZSA-N. The full InChI is InChI=1S/C18H20N2O4/c21-17(16-6-8-19-24-16)20-9-7-18(13-20)10-15(12-23-18)22-11-14-4-2-1-3-5-14/h1-6,8,15H,7,9-13H2/t15-,18-/m0/s1.
What are the key properties of 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone?
1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone has a molecular weight of 328.37 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazol-5-yl-[(3S,5S)-3-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone is sourced from PubChem (CID 97394314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).