C19H27N3O — CID 97397463
8-(cyclopropylmethylamino)-1-(pyridin-4-ylmethyl)-1-azaspiro[4.5]decan-2-one (PubChem CID 97397463) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 8-(cyclopropylmethylamino)-1-(pyridin-4-ylmethyl)-1-azaspiro[4.5]decan-2-one.
| Compound Name | 8-(cyclopropylmethylamino)-1-(pyridin-4-ylmethyl)-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97397463 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 8-(cyclopropylmethylamino)-1-(pyridin-4-ylmethyl)-1-azaspiro[4.5]decan-2-one |
| SMILES | O=C1CCC2(CCC(NCC3CC3)CC2)N1Cc1ccncc1 |
| InChI | InChI=1S/C19H27N3O/c23-18-5-10-19(22(18)14-16-6-11-20-12-7-16)8-3-17(4-9-19)21-13-15-1-2-15/h6-7,11-12,15,17,21H,1-5,8-10,13-14H2 |
| InChIKey | HSMLKGWHWUDEKC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |