About (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane
(4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane (PubChem CID 97399268) has the molecular formula C9H17FN2
and a molecular weight of 172.25 g/mol. Its IUPAC name is (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane |
| PubChem CID | 97399268 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane |
| SMILES | FCCN1CC[C@@]12CCCNC2 |
| InChI | InChI=1S/C9H17FN2/c10-4-7-12-6-3-9(12)2-1-5-11-8-9/h11H,1-8H2/t9-/m1/s1 |
| InChIKey | ZIPSAPUHGQJTGI-SECBINFHSA-N |
| XLogP | 0.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane?
The IUPAC name of (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane (CID 97399268) is (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane.
What is the SMILES notation for (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane?
The canonical SMILES for (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane is FCCN1CC[C@@]12CCCNC2.
What is the InChIKey of (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane?
The InChIKey is ZIPSAPUHGQJTGI-SECBINFHSA-N. The full InChI is InChI=1S/C9H17FN2/c10-4-7-12-6-3-9(12)2-1-5-11-8-9/h11H,1-8H2/t9-/m1/s1.
What are the key properties of (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane?
(4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane has a molecular weight of 172.25 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(2-fluoroethyl)-1,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 97399268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).