About 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone
2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone (PubChem CID 97399531) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone |
| PubChem CID | 97399531 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone |
| SMILES | O=C(CO)N1CCC2(CC1)COCCN(c1nccs1)C2 |
| InChI | InChI=1S/C14H21N3O3S/c18-9-12(19)16-4-1-14(2-5-16)10-17(6-7-20-11-14)13-15-3-8-21-13/h3,8,18H,1-2,4-7,9-11H2 |
| InChIKey | WFUCOEWWLNYPGE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone?
The IUPAC name of 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone (CID 97399531) is 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone.
What is the SMILES notation for 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone?
The canonical SMILES for 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone is O=C(CO)N1CCC2(CC1)COCCN(c1nccs1)C2.
What is the InChIKey of 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone?
The InChIKey is WFUCOEWWLNYPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c18-9-12(19)16-4-1-14(2-5-16)10-17(6-7-20-11-14)13-15-3-8-21-13/h3,8,18H,1-2,4-7,9-11H2.
What are the key properties of 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone?
2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone has a molecular weight of 311.41 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]ethanone is sourced from PubChem (CID 97399531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).