C19H21N5O — CID 97400033
2-[1'-(5-methyl-1H-pyrazole-3-carbonyl)spiro[2H-indole-3,4'-piperidine]-1-yl]acetonitrile (PubChem CID 97400033) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[1'-(5-methyl-1H-pyrazole-3-carbonyl)spiro[2H-indole-3,4'-piperidine]-1-yl]acetonitrile.
| Compound Name | 2-[1'-(5-methyl-1H-pyrazole-3-carbonyl)spiro[2H-indole-3,4'-piperidine]-1-yl]acetonitrile |
|---|---|
| PubChem CID | 97400033 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[1'-(5-methyl-1H-pyrazole-3-carbonyl)spiro[2H-indole-3,4'-piperidine]-1-yl]acetonitrile |
| SMILES | Cc1cc(C(=O)N2CCC3(CC2)CN(CC#N)c2ccccc23)n[nH]1 |
| InChI | InChI=1S/C19H21N5O/c1-14-12-16(22-21-14)18(25)23-9-6-19(7-10-23)13-24(11-8-20)17-5-3-2-4-15(17)19/h2-5,12H,6-7,9-11,13H2,1H3,(H,21,22) |
| InChIKey | BMXPRIYDERDZSW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|