About N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide
N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide (PubChem CID 97400068) has the molecular formula C18H25N3O4S
and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide |
| PubChem CID | 97400068 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide |
| SMILES | CCS(=O)(=O)N1CC2(CCN(C(=O)CNC(C)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H25N3O4S/c1-3-26(24,25)21-13-18(15-6-4-5-7-16(15)21)8-10-20(11-9-18)17(23)12-19-14(2)22/h4-7H,3,8-13H2,1-2H3,(H,19,22) |
| InChIKey | KEVPBCHEYNFBSC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide?
The IUPAC name of N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide (CID 97400068) is N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide.
What is the SMILES notation for N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide?
The canonical SMILES for N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide is CCS(=O)(=O)N1CC2(CCN(C(=O)CNC(C)=O)CC2)c2ccccc21.
What is the InChIKey of N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide?
The InChIKey is KEVPBCHEYNFBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4S/c1-3-26(24,25)21-13-18(15-6-4-5-7-16(15)21)8-10-20(11-9-18)17(23)12-19-14(2)22/h4-7H,3,8-13H2,1-2H3,(H,19,22).
What are the key properties of N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide?
N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide has a molecular weight of 379.48 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-ethylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-oxoethyl]acetamide is sourced from PubChem (CID 97400068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).