About 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one
1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 97400100) has the molecular formula C20H19N5OS
and a molecular weight of 377.47 g/mol. Its IUPAC name is 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 97400100 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | O=C1N(Cc2nccs2)c2ccccc2C12CCN(c1cnccn1)CC2 |
| InChI | InChI=1S/C20H19N5OS/c26-19-20(5-10-24(11-6-20)17-13-21-7-8-22-17)15-3-1-2-4-16(15)25(19)14-18-23-9-12-27-18/h1-4,7-9,12-13H,5-6,10-11,14H2 |
| InChIKey | LXPPZIDRJNXPPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one (CID 97400100) is 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one is O=C1N(Cc2nccs2)c2ccccc2C12CCN(c1cnccn1)CC2.
What is the InChIKey of 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one?
The InChIKey is LXPPZIDRJNXPPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5OS/c26-19-20(5-10-24(11-6-20)17-13-21-7-8-22-17)15-3-1-2-4-16(15)25(19)14-18-23-9-12-27-18/h1-4,7-9,12-13H,5-6,10-11,14H2.
What are the key properties of 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one?
1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one has a molecular weight of 377.47 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-pyrazin-2-yl-1-(1,3-thiazol-2-ylmethyl)spiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 97400100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).