About 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one
1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one (PubChem CID 97401389) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one |
| PubChem CID | 97401389 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one |
| SMILES | O=C(c1ccno1)N1CCC2(CC1)CC(=O)N(CC1CC1)c1ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c25-19-13-21(8-11-23(12-9-21)20(26)18-7-10-22-27-18)16-3-1-2-4-17(16)24(19)14-15-5-6-15/h1-4,7,10,15H,5-6,8-9,11-14H2 |
| InChIKey | PTJQEFPJVOLBFS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one?
The IUPAC name of 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one (CID 97401389) is 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one.
What is the SMILES notation for 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one?
The canonical SMILES for 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one is O=C(c1ccno1)N1CCC2(CC1)CC(=O)N(CC1CC1)c1ccccc12.
What is the InChIKey of 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one?
The InChIKey is PTJQEFPJVOLBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c25-19-13-21(8-11-23(12-9-21)20(26)18-7-10-22-27-18)16-3-1-2-4-17(16)24(19)14-15-5-6-15/h1-4,7,10,15H,5-6,8-9,11-14H2.
What are the key properties of 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one?
1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one has a molecular weight of 365.43 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-1'-(1,2-oxazole-5-carbonyl)spiro[3H-quinoline-4,4'-piperidine]-2-one is sourced from PubChem (CID 97401389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).