C20H25N3O2 — CID 97401403
2-[2-oxo-1-[[(2S)-oxolan-2-yl]methyl]spiro[3H-quinoline-4,4'-piperidine]-1'-yl]acetonitrile (PubChem CID 97401403) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[2-oxo-1-[[(2S)-oxolan-2-yl]methyl]spiro[3H-quinoline-4,4'-piperidine]-1'-yl]acetonitrile.
| Compound Name | 2-[2-oxo-1-[[(2S)-oxolan-2-yl]methyl]spiro[3H-quinoline-4,4'-piperidine]-1'-yl]acetonitrile |
|---|---|
| PubChem CID | 97401403 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-[2-oxo-1-[[(2S)-oxolan-2-yl]methyl]spiro[3H-quinoline-4,4'-piperidine]-1'-yl]acetonitrile |
| SMILES | N#CCN1CCC2(CC1)CC(=O)N(C[C@@H]1CCCO1)c1ccccc12 |
| InChI | InChI=1S/C20H25N3O2/c21-9-12-22-10-7-20(8-11-22)14-19(24)23(15-16-4-3-13-25-16)18-6-2-1-5-17(18)20/h1-2,5-6,16H,3-4,7-8,10-15H2/t16-/m0/s1 |
| InChIKey | IOWVAPRWXUIDRK-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|